2(1H)-Quinolinone,7-amino-4-(trifluoromethyl)- structure
|
Common Name | 2(1H)-Quinolinone,7-amino-4-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 58721-76-9 | Molecular Weight | 228.17100 | |
| Density | 1.468g/cm3 | Boiling Point | 350.1ºC at 760mmHg | |
| Molecular Formula | C10H7F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.6ºC | |
| Name | 7-amino-4-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.468g/cm3 |
|---|---|
| Boiling Point | 350.1ºC at 760mmHg |
| Molecular Formula | C10H7F3N2O |
| Molecular Weight | 228.17100 |
| Flash Point | 165.6ºC |
| Exact Mass | 228.05100 |
| PSA | 58.88000 |
| LogP | 2.71030 |
| Index of Refraction | 1.563 |
| InChIKey | JBCMJMNWLFZJNV-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(C(F)(F)F)cc(=O)[nH]c2c1 |
|
~69%
2(1H)-Quinolino... CAS#:58721-76-9 |
| Literature: Kathuria, Abha; Priya, Nivedita; Chand, Karam; Singh, Prabhjot; Gupta, Anjali; Jalal, Sarah; Gupta, Shilpi; Raj, Hanumantharao G.; Sharma, Sunil K. Bioorganic and Medicinal Chemistry, 2012 , vol. 20, # 4 p. 1624 - 1638 |
|
~%
2(1H)-Quinolino... CAS#:58721-76-9 |
| Literature: van Oeveren, Arjan; Pio, Barbara A.; Tegley, Christopher M.; Higuchi, Robert I.; Wu, Min; Jones, Todd K.; Marschke, Keith B.; Negro-Vilar, Andres; Zhi, Lin Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 6 p. 1523 - 1526 |
|
~%
2(1H)-Quinolino... CAS#:58721-76-9 |
| Literature: Reszka, Przemyslaw; Schulz, Riad; Methling, Karen; Lalk, Michael; Bednarski, Patrick J. ChemMedChem, 2010 , vol. 5, # 1 p. 103 - 117 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| AFMeQ |
| amino-2-quinolinone,8 |
| 7-amino-4-trifluromethyl-quinolone |
| 7-amino-4-trifluoromethyl-1H-quinolin-2-one |
| 7-amino-4-(trifluoromethyl)quinolin-2(1h)-one |
| 7-amino-4-(trifluoromethyl)-2(1H)-quinolinone |
| 7-Amino-4-trifluoromethyl-2-quinolinone |