1-(4-piperidin-1-ylsulfonylphenyl)ethanone
1-(4-piperidin-1-ylsulfonylphenyl)ethanone structure
|
Common Name | 1-(4-piperidin-1-ylsulfonylphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 58722-34-2 | Molecular Weight | 267.34400 | |
| Density | 1.235g/cm3 | Boiling Point | 428.9ºC at 760mmHg | |
| Molecular Formula | C13H17NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-piperidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 428.9ºC at 760mmHg |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.34400 |
| Flash Point | 213.2ºC |
| Exact Mass | 267.09300 |
| PSA | 62.83000 |
| LogP | 3.08250 |
| Index of Refraction | 1.559 |
| InChIKey | MIBYJBHDWBZZDA-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2935009090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~96%
1-(4-piperidin-... CAS#:58722-34-2 |
| Literature: AMGEN, INC. Patent: WO2006/66172 A1, 2006 ; Location in patent: Page/Page column 34-35 ; WO 2006/066172 A1 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-piperidinosulfonylacetophenone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 1-(4-piperidin-1-ylsulfonylphenyl)ethanone have? |
| A: English synonyms of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone: p-piperidinosulfonylacetophenone. |
| Q: What is the boiling point of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone? |
| A: Boiling point of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone is 428.9ºC at 760mmHg. |
| Q: What is the molecular weight of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone? |
| A: Molecular weight of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone is 267.34400. |
| Q: What is the InChIKey of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone? |
| A: InChIKey of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone is MIBYJBHDWBZZDA-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone? |
| A: The English name of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone is 1-(4-piperidin-1-ylsulfonylphenyl)ethanone. |
| Q: What is the SMILES notation of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone? |
| A: SMILES notation of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone is CC(=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1. |
| Q: What is the CAS number of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone? |
| A: CAS number of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone is 58722-34-2. |
| Q: What is the polar surface area (PSA) of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone? |
| A: Polar surface area (PSA) of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone is 62.83000. |
| Q: What is the LogP of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone? |
| A: LogP of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone is 3.08250. |
| Q: What is the molecular formula of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone? |
| A: Molecular formula of 1-(4-piperidin-1-ylsulfonylphenyl)ethanone is C13H17NO3S. |