1-[(4-methylphenyl)sulfonylmethyl]pyridine; trifluoromethanesulfonic acid structure
|
Common Name | 1-[(4-methylphenyl)sulfonylmethyl]pyridine; trifluoromethanesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 58747-50-5 | Molecular Weight | 397.39000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14F3NO5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(4-methylphenyl)sulfonylmethyl]pyridin-1-ium,trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14F3NO5S2 |
|---|---|
| Molecular Weight | 397.39000 |
| Exact Mass | 397.02700 |
| PSA | 111.98000 |
| LogP | 3.92690 |
| InChIKey | TVTJRKLPWKDQSQ-UHFFFAOYSA-M |
| SMILES | Cc1ccc(S(=O)(=O)C[n+]2ccccc2)cc1.O=S(=O)([O-])C(F)(F)F |
|
~%
1-[(4-methylphe... CAS#:58747-50-5 |
| Literature: Zhdankin; Erickson; Hanson Journal of the American Chemical Society, 1997 , vol. 119, # 20 p. 4775 - 4776 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-p-toluenesulfonylmethylpyridinium triflate |