G-Glu-Ser
Modify Date: 2026-07-01 21:51:37
G-Glu-Ser structure
|
Common Name | G-Glu-Ser | ||
|---|---|---|---|---|
| CAS Number | 5875-35-4 | Molecular Weight | 234.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of G-Glu-SerActivator of calcium receptor; Flavor-enriching agent |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | G-Glu-Ser |
|---|
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | Activator of calcium receptor; Flavor-enriching agent |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H14N2O6 |
|---|---|
| Molecular Weight | 234.21 |
| InChIKey | SQBNIUOYNOKDTI-WHFBIAKZSA-N |
| SMILES | NC(CCC(=O)NC(CO)C(=O)O)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of G-Glu-Ser? |
| A: InChIKey of G-Glu-Ser is SQBNIUOYNOKDTI-WHFBIAKZSA-N. |
| Q: What is the Chinese name of 5875-35-4? |
| A: Chinese name of 5875-35-4 is 5875-35-4. |
| Q: What is the molecular formula of G-Glu-Ser? |
| A: Molecular formula of G-Glu-Ser is C8H14N2O6. |
| Q: What is the English name of G-Glu-Ser? |
| A: The English name of G-Glu-Ser is G-Glu-Ser. |
| Q: What is the molecular weight of G-Glu-Ser? |
| A: Molecular weight of G-Glu-Ser is 234.21. |
| Q: What is the SMILES notation of G-Glu-Ser? |
| A: SMILES notation of G-Glu-Ser is NC(CCC(=O)NC(CO)C(=O)O)C(=O)O. |
| Q: What is the CAS number of G-Glu-Ser? |
| A: CAS number of G-Glu-Ser is 5875-35-4. |
| Q: What are the uses of G-Glu-Ser? |
| A: Main uses of G-Glu-Ser: Activator of calcium receptor; Flavor-enriching agent. |