N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide
![N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide Structure](https://image.chemsrc.com/caspic/455/5875-75-2.png)
N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide structure
|
Common Name | N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 5875-75-2 | Molecular Weight | 337.32900 | |
| Density | 1.335g/cm3 | Boiling Point | 516.4ºC at 760mmHg | |
| Molecular Formula | C18H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 516.4ºC at 760mmHg |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.32900 |
| Flash Point | 266.1ºC |
| Exact Mass | 337.10600 |
| PSA | 92.16000 |
| LogP | 4.51400 |
| Index of Refraction | 1.644 |
| InChIKey | BOAXHUFLNOCEAZ-UHFFFAOYSA-N |
| SMILES | CC(c1ccco1)N(C(=O)c1ccc([N+](=O)[O-])cc1)c1ccccn1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~51%
N-[1-(furan-2-y... CAS#:5875-75-2 |
| Literature: Yang, Guo Ying; Hanack, Michael; Lee, Yiew Wang; Chen, Yu; Lee, May Ka Yuen; Dini, Danilo Chemistry - A European Journal, 2003 , vol. 9, # 12 p. 2758 - 2762 |
|
~%
N-[1-(furan-2-y... CAS#:5875-75-2 |
| Literature: Davies, John W.; Durrant, Michael L.; Walker, Matthew P.; Belkacemi, Djaballah; Malpass, John R. Tetrahedron, 1992 , vol. 48, # 5 p. 861 - 884 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Contractile Force Screening of ChemBridge Diverset library for asthma drug discovery
Source: 24015
Target: N/A
External Id: HSPH_Screening_CFS_002
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-methyl-5,6,7,8-tetrafluoro-1,4-dihydro-1,4-iminonaphtalene |
| 1,2,3,4-Tetrafluor-5,8-dihydro-5,8-(N-methylimino)-naphthalin |
| 9-methyl-5,6,7,8-tetrafluoro-1,4-dihydronaphthalen-1,4-imine |
| 5,6,7,8-tetrafluoro-9-methyl-1,4-dihydro-1,4-epiazano-naphthalene |
| 1,2,3,4-tetrafluoro-5,8-dihydro-5,8-N-methylaminonaphthalene |
| 9-methyl-9-aza-5,6,7,8-tetrafluorobenzonorbornadiene |
| 9-Methyl-5,6,7,8-tetrafluoro-1,4-dihydronaphthalin-1,6-imin |
| T0501-0925 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide? |
| A: Boiling point of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide is 516.4ºC at 760mmHg. |
| Q: What is the molecular weight of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide? |
| A: Molecular weight of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide is 337.32900. |
| Q: What is the CAS number of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide? |
| A: CAS number of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide is 5875-75-2. |
| Q: What is the LogP of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide? |
| A: LogP of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide is 4.51400. |
| Q: What is the InChIKey of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide? |
| A: InChIKey of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide is BOAXHUFLNOCEAZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide? |
| A: SMILES notation of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide is CC(c1ccco1)N(C(=O)c1ccc([N+](=O)[O-])cc1)c1ccccn1. |
| Q: What is the polar surface area (PSA) of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide? |
| A: Polar surface area (PSA) of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide is 92.16000. |
| Q: What is the Chinese name of 5875-75-2? |
| A: Chinese name of 5875-75-2 is 5875-75-2. |
| Q: What is the molecular formula of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide? |
| A: Molecular formula of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide is C18H15N3O4. |
| Q: What is the English name of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide? |
| A: The English name of N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide is N-[1-(furan-2-yl)ethyl]-4-nitro-N-pyridin-2-ylbenzamide. |