N-(3,5-dinitropyridin-2-yl)-2,1,3-benzothiadiazol-4-amine structure
|
Common Name | N-(3,5-dinitropyridin-2-yl)-2,1,3-benzothiadiazol-4-amine | ||
|---|---|---|---|---|
| CAS Number | 5876-30-2 | Molecular Weight | 318.26800 | |
| Density | 1.744g/cm3 | Boiling Point | 488ºC at 760 mmHg | |
| Molecular Formula | C11H6N6O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.9ºC | |
| Name | N-(3,5-dinitropyridin-2-yl)-2,1,3-benzothiadiazol-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.744g/cm3 |
|---|---|
| Boiling Point | 488ºC at 760 mmHg |
| Molecular Formula | C11H6N6O4S |
| Molecular Weight | 318.26800 |
| Flash Point | 248.9ºC |
| Exact Mass | 318.01700 |
| PSA | 170.58000 |
| LogP | 3.76570 |
| Index of Refraction | 1.817 |
| InChIKey | ABXVTBBJEWIKOB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc(Nc2cccc3nsnc23)c([N+](=O)[O-])c1 |
| HS Code | 2934999090 |
|---|
|
~%
N-(3,5-dinitrop... CAS#:5876-30-2 |
| Literature: Nazrullaev; Bessonova; Akhmedkhodzhaeva Chemistry of Natural Compounds, 2001 , vol. 37, # 6 p. 551 - 555 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,4,5-trimethoxy-benzoic acid 4,8-dimethoxy-furo[2,3-b]quinolin-7-yl ester |
| O-(3,4,5-trimethoxybenzoyl)haplopine |