1-phenyl-1-(propan-2-ylideneamino)urea
1-phenyl-1-(propan-2-ylideneamino)urea structure
|
Common Name | 1-phenyl-1-(propan-2-ylideneamino)urea | ||
|---|---|---|---|---|
| CAS Number | 5877-04-3 | Molecular Weight | 191.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-phenyl-1-(propan-2-ylideneamino)urea |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13N3O |
|---|---|
| Molecular Weight | 191.23000 |
| Exact Mass | 191.10600 |
| PSA | 59.68000 |
| LogP | 2.48130 |
| InChIKey | ALJGTPBZYQPNAC-UHFFFAOYSA-N |
| SMILES | CC(C)=NN(C(N)=O)c1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2928000090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-phenyl-1-(pro... CAS#:5877-04-3 |
| Literature: Schildknecht; Hatzmann Justus Liebigs Annalen der Chemie, 1969 , vol. 724, p. 226 |
|
~%
1-phenyl-1-(pro... CAS#:5877-04-3 |
| Literature: Arnold Chemische Berichte, 1897 , vol. 30, p. 1016 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Hydrazinecarboxamide,2-(1-methylethylidene)-1-phenyl |
| acetone-(2-phenyl semicarbazone) |
| Aceton-(carbamoyl-phenyl-hydrazon) |
| Aceton-(2-phenyl-semicarbazon) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-phenyl-1-(propan-2-ylideneamino)urea? |
| A: InChIKey of 1-phenyl-1-(propan-2-ylideneamino)urea is ALJGTPBZYQPNAC-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-phenyl-1-(propan-2-ylideneamino)urea? |
| A: CAS number of 1-phenyl-1-(propan-2-ylideneamino)urea is 5877-04-3. |
| Q: What is the polar surface area (PSA) of 1-phenyl-1-(propan-2-ylideneamino)urea? |
| A: Polar surface area (PSA) of 1-phenyl-1-(propan-2-ylideneamino)urea is 59.68000. |
| Q: What English synonyms does 1-phenyl-1-(propan-2-ylideneamino)urea have? |
| A: English synonyms of 1-phenyl-1-(propan-2-ylideneamino)urea: Hydrazinecarboxamide,2-(1-methylethylidene)-1-phenyl, acetone-(2-phenyl semicarbazone), Aceton-(carbamoyl-phenyl-hydrazon), Aceton-(2-phenyl-semicarbazon). |
| Q: What is the SMILES notation of 1-phenyl-1-(propan-2-ylideneamino)urea? |
| A: SMILES notation of 1-phenyl-1-(propan-2-ylideneamino)urea is CC(C)=NN(C(N)=O)c1ccccc1. |
| Q: What is the molecular formula of 1-phenyl-1-(propan-2-ylideneamino)urea? |
| A: Molecular formula of 1-phenyl-1-(propan-2-ylideneamino)urea is C10H13N3O. |
| Q: What is the LogP of 1-phenyl-1-(propan-2-ylideneamino)urea? |
| A: LogP of 1-phenyl-1-(propan-2-ylideneamino)urea is 2.48130. |
| Q: What is the molecular weight of 1-phenyl-1-(propan-2-ylideneamino)urea? |
| A: Molecular weight of 1-phenyl-1-(propan-2-ylideneamino)urea is 191.23000. |
| Q: What is the English name of 1-phenyl-1-(propan-2-ylideneamino)urea? |
| A: The English name of 1-phenyl-1-(propan-2-ylideneamino)urea is 1-phenyl-1-(propan-2-ylideneamino)urea. |
| Q: What is the Chinese name of 5877-04-3? |
| A: Chinese name of 5877-04-3 is 5877-04-3. |