1-bromo-2,4,5-trimethyl-3,6-dinitro-benzene structure
|
Common Name | 1-bromo-2,4,5-trimethyl-3,6-dinitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 5877-60-1 | Molecular Weight | 289.08300 | |
| Density | 1.622g/cm3 | Boiling Point | 357.2ºC at 760 mmHg | |
| Molecular Formula | C9H9BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.9ºC | |
| Name | 1-bromo-2,4,5-trimethyl-3,6-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.622g/cm3 |
|---|---|
| Boiling Point | 357.2ºC at 760 mmHg |
| Molecular Formula | C9H9BrN2O4 |
| Molecular Weight | 289.08300 |
| Flash Point | 169.9ºC |
| Exact Mass | 287.97500 |
| PSA | 91.64000 |
| LogP | 4.23710 |
| Index of Refraction | 1.606 |
| InChIKey | ZMHKCOHMNLOBFO-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c([N+](=O)[O-])c(Br)c(C)c1[N+](=O)[O-] |
| HS Code | 2904909090 |
|---|
|
~%
1-bromo-2,4,5-t... CAS#:5877-60-1 |
| Literature: Smith; Johnson Journal of the American Chemical Society, 1937 , vol. 59, p. 673,678 |
|
~%
1-bromo-2,4,5-t... CAS#:5877-60-1 |
| Literature: Kelbe; Pathe Chemische Berichte, 1886 , vol. 19, p. 1551 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene,1-bromo-2,4,5-trimethyl-3,6-dinitro |
| 1-bromo-2,4,5-trimethyl-3,6-dinitro-benzene |
| Benzene,4,5-trimethyl-3,6-dinitro |
| 5-Brom-3,6-dinitro-pseudocumol |
| 1-Brom-2,4,5-trimethyl-3,6-dinitro-benzol |