Diazene,1,2-bis(3-methylphenyl) structure
|
Common Name | Diazene,1,2-bis(3-methylphenyl) | ||
|---|---|---|---|---|
| CAS Number | 588-04-5 | Molecular Weight | 210.27400 | |
| Density | 1g/cm3 | Boiling Point | 352.9ºC at 760mmHg | |
| Molecular Formula | C14H14N2 | Melting Point | 53 °C | |
| MSDS | N/A | Flash Point | 159.5ºC | |
Use of Diazene,1,2-bis(3-methylphenyl)Solubility in hot Methanol:almost transparency |
| Name | 3,3'-dimethylazobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 352.9ºC at 760mmHg |
| Melting Point | 53 °C |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.27400 |
| Flash Point | 159.5ºC |
| Exact Mass | 210.11600 |
| PSA | 24.72000 |
| LogP | 4.71880 |
| Index of Refraction | 1.562 |
| InChIKey | HPSZIXYLILUGIP-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N=Nc2cccc(C)c2)c1 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| m,m'-dimethylazobenzene |
| M-AZOTOLUENE |
| EINECS 209-609-8 |
| di-m-tolyldiazene |