diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate
diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate structure
|
Common Name | diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 58809-99-7 | Molecular Weight | 309.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H19NO6 |
|---|---|
| Molecular Weight | 309.31400 |
| Exact Mass | 309.12100 |
| PSA | 98.42000 |
| LogP | 2.81030 |
| InChIKey | MDXZGRYKUYTRRN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)c1ccc([N+](=O)[O-])c(C)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~57%
diethyl 2-methy... CAS#:58809-99-7 |
| Literature: Maeda; Ohsugi; Fujioka; Hirose Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3424 - 3445 |
|
~%
diethyl 2-methy... CAS#:58809-99-7 |
| Literature: Hino; Nakamura; Nagai; Uno; Nishimura Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 222 - 226 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Propanedioic acid,methyl(3-methyl-4-nitrophenyl)-,diethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate? |
| A: InChIKey of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate is MDXZGRYKUYTRRN-UHFFFAOYSA-N. |
| Q: What is the CAS number of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate? |
| A: CAS number of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate is 58809-99-7. |
| Q: What is the Chinese name of 58809-99-7? |
| A: Chinese name of 58809-99-7 is 58809-99-7. |
| Q: What is the polar surface area (PSA) of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate? |
| A: Polar surface area (PSA) of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate is 98.42000. |
| Q: What is the LogP of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate? |
| A: LogP of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate is 2.81030. |
| Q: What is the English name of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate? |
| A: The English name of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate is diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate. |
| Q: What English synonyms does diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate have? |
| A: English synonyms of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate: Propanedioic acid,methyl(3-methyl-4-nitrophenyl)-,diethyl ester. |
| Q: What is the SMILES notation of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate? |
| A: SMILES notation of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate is CCOC(=O)C(C)(C(=O)OCC)c1ccc([N+](=O)[O-])c(C)c1. |
| Q: What is the molecular formula of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate? |
| A: Molecular formula of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate is C15H19NO6. |
| Q: What is the molecular weight of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate? |
| A: Molecular weight of diethyl 2-methyl-2-(3-methyl-4-nitrophenyl)propanedioate is 309.31400. |