Butanamide,N-[(4-methylphenyl)sulfonyl]- structure
|
Common Name | Butanamide,N-[(4-methylphenyl)sulfonyl]- | ||
|---|---|---|---|---|
| CAS Number | 58821-26-4 | Molecular Weight | 241.30700 | |
| Density | 1.189g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-methylphenyl)sulfonylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.30700 |
| Exact Mass | 241.07700 |
| PSA | 71.62000 |
| LogP | 3.07170 |
| Index of Refraction | 1.527 |
| InChIKey | HXVBEGTXQVNSQD-UHFFFAOYSA-N |
| SMILES | CCCC(=O)NS(=O)(=O)c1ccc(C)cc1 |
|
~93%
Butanamide,N-[(... CAS#:58821-26-4 |
| Literature: Wang, Feng; Liu, Hongxia; Fu, Hua; Jiang, Yuyang; Zhao, Yufen Advanced Synthesis and Catalysis, 2009 , vol. 351, # 1-2 p. 246 - 252 |
|
~92%
Butanamide,N-[(... CAS#:58821-26-4 |
| Literature: Massah, Ahmad Reza; Momeni, Ahmad Reza; Dabagh, Mina; Aliyan, Hamid; Naghash, Hamid Javaherian Synthetic Communications, 2008 , vol. 38, # 2 p. 265 - 273 |
|
~70%
Butanamide,N-[(... CAS#:58821-26-4 |
| Literature: Chen, Guo-Qiang; Xu, Zhen-Jiang; Liu, Yungen; Zhou, Cong-Ying; Che, Chi-Ming Synlett, 2011 , # 8 art. no. W00411ST, p. 1174 - 1178 |
| butyryl-(toluene-4-sulfonyl)-amine |
| N-butanoyl-4-methyl-benzenesulfonamide |
| n-[(4-methylphenyl)sulfonyl]butanamide |
| N-butyryl-p-toluenesulphonamide |
| N-tosylbutyramide |
| Butyryl-(toluol-4-sulfonyl)-amin |
| N-butyryl-4-methyl-benzenesulfonamide |