1,3,5-tris[(4-methoxyphenyl)methyl]-1,3,5-triazinane
Modify Date: 2026-07-28 11:07:34
![1,3,5-tris[(4-methoxyphenyl)methyl]-1,3,5-triazinane Structure](https://image.chemsrc.com/caspic/280/58837-16-4.png)
1,3,5-tris[(4-methoxyphenyl)methyl]-1,3,5-triazinane structure
|
Common Name | 1,3,5-tris[(4-methoxyphenyl)methyl]-1,3,5-triazinane | ||
|---|---|---|---|---|
| CAS Number | 58837-16-4 | Molecular Weight | 447.56900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H33N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3,5-tris[(4-methoxyphenyl)methyl]-1,3,5-triazinane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H33N3O3 |
|---|---|
| Molecular Weight | 447.56900 |
| Exact Mass | 447.25200 |
| PSA | 37.41000 |
| LogP | 4.21860 |
| InChIKey | GZFOOFLYIFPAEM-UHFFFAOYSA-N |
| SMILES | COc1ccc(CN2CN(Cc3ccc(OC)cc3)CN(Cc3ccc(OC)cc3)C2)cc1 |
|
~%
1,3,5-tris[(4-m... CAS#:58837-16-4 |
| Literature: Sumitomo Chemical Company, Limited Patent: EP1961733 A1, 2008 ; Location in patent: Page/Page column 9 ; |
|
~93%
1,3,5-tris[(4-m... CAS#:58837-16-4 |
| Literature: Shiozaki, Masao; Masuko, Hidekazu Bulletin of the Chemical Society of Japan, 1987 , vol. 60, # 2 p. 645 - 648 |
| 1,3,5-Triazine,hexahydro-1,3,5-tris[(4-methoxyphenyl)methyl] |
| 1,3,5-tris(4-methoxybenzyl)hexahydro-1,3,5-triazine |
| 1,3,5-tris(p-methoxybenzyl)-hexahydro-1,3,5-triazine |
| 1,3,5-tris(4-methoxybenzyl)-1,3,5-hexahydrotriazine |
| 1,3,5-tris-(4-methoxy-benzyl)-[1,3,5]triazinane |