2-[(2,3-Dimethylphenyl)thio]benzoic acid structure
|
Common Name | 2-[(2,3-Dimethylphenyl)thio]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 58844-67-0 | Molecular Weight | 258.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,3-dimethylphenylthio)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O2S |
|---|---|
| Molecular Weight | 258.33500 |
| Exact Mass | 258.07100 |
| PSA | 62.60000 |
| LogP | 4.15280 |
| InChIKey | IUHMFGGYIMDALM-UHFFFAOYSA-N |
| SMILES | Cc1cccc(Sc2ccccc2C(=O)O)c1C |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Name: Antiinflammatory activity in Holtzman rat assessed as inhibition of carrageenan-induc...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3281288
|
|
Name: Antiinflammatory activity in Holtzman rat assessed as inhibition of UV radiation-indu...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3281290
|
|
Name: Toxicity in mouse assessed as mortality at >= 0.3 g/kg, ip
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL3281295
|
| 2-(2,3-dimethylphenyl)sulfanylbenzoic acid |