Naphthalene,1,2,3,4-tetrahydro-1,1,4,4,6,7-hexamethyl- structure
|
Common Name | Naphthalene,1,2,3,4-tetrahydro-1,1,4,4,6,7-hexamethyl- | ||
|---|---|---|---|---|
| CAS Number | 58848-15-0 | Molecular Weight | 216.36200 | |
| Density | 0.88g/cm3 | Boiling Point | 286.8ºC at 760 mmHg | |
| Molecular Formula | C16H24 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.1ºC | |
| Name | 1,1,4,4,6,7-hexamethyl-2,3-dihydronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.88g/cm3 |
|---|---|
| Boiling Point | 286.8ºC at 760 mmHg |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.36200 |
| Flash Point | 124.1ºC |
| Exact Mass | 216.18800 |
| LogP | 4.65240 |
| Index of Refraction | 1.492 |
| InChIKey | OBUKANCGVSOHAC-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(cc1C)C(C)(C)CCC2(C)C |
|
~91%
Naphthalene,1,2... CAS#:58848-15-0 |
| Literature: Fehr, Charles; Galindo, Jose; Haubrichs, Rolf; Perret, Roland Helvetica Chimica Acta, 1989 , vol. 72, p. 1537 - 1553 |
|
~%
Naphthalene,1,2... CAS#:58848-15-0 |
| Literature: Fehr, Charles; Galindo, Jose; Haubrichs, Rolf; Perret, Roland Helvetica Chimica Acta, 1989 , vol. 72, p. 1537 - 1553 |
|
~%
Naphthalene,1,2... CAS#:58848-15-0 |
| Literature: Wood,T.F. et al. Journal of Organic Chemistry, 1963 , vol. 28, p. 2248 - 2255 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1,4,4,6,7-hexamethyltetraline |
| 1,1,4,4,6,7-hexamethyl-1,2,3,4-tetrahydro-naphthalene |
| 1,2,3,4-tetrahydro-1,1,4,4,6,7-hexamethylnaphthalene |
| 2,3,5,5,8,8-hexamethyl-5,6,7,8-tetrahydronaphthalene |
| 1,1,4,4,6,7-hexamethyltetralin |