2-[(2-methyl-1H-indol-5-yl)methyl]isoindole-1,3-dione structure
|
Common Name | 2-[(2-methyl-1H-indol-5-yl)methyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 58867-56-4 | Molecular Weight | 290.31600 | |
| Density | 1.385g/cm3 | Boiling Point | 514.5ºC at 760 mmHg | |
| Molecular Formula | C18H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265ºC | |
| Name | 2-[(2-methyl-1H-indol-5-yl)methyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.385g/cm3 |
|---|---|
| Boiling Point | 514.5ºC at 760 mmHg |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.31600 |
| Flash Point | 265ºC |
| Exact Mass | 290.10600 |
| PSA | 53.17000 |
| LogP | 3.21040 |
| Index of Refraction | 1.732 |
| InChIKey | HMUPURVYUXMPBS-UHFFFAOYSA-N |
| SMILES | Cc1cc2cc(CN3C(=O)c4ccccc4C3=O)ccc2[nH]1 |
|
~96%
2-[(2-methyl-1H... CAS#:58867-56-4 |
| Literature: Muminov, A.; Yudin, L. G.; Zinchenko, E. Ya.; Romanova, N. N.; Kost, A. N. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1985 , vol. 21, # 9 p. 1012 - 1015 Khimiya Geterotsiklicheskikh Soedinenii, 1985 , vol. 21, # 9 p. 1218 - 1221 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| f0651-0124 |