Benzoic acid, 2,4,5-trimethoxy-, hydrazide (9CI)
Modify Date: 2025-09-29 10:01:34
Benzoic acid, 2,4,5-trimethoxy-, hydrazide (9CI) structure
|
Common Name | Benzoic acid, 2,4,5-trimethoxy-, hydrazide (9CI) | ||
|---|---|---|---|---|
| CAS Number | 588677-34-3 | Molecular Weight | 226.22900 | |
| Density | 1.197g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4,5-Trimethoxybenzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.22900 |
| Exact Mass | 226.09500 |
| PSA | 82.81000 |
| LogP | 1.40710 |
| Index of Refraction | 1.534 |
| InChIKey | MGDMATIDPSOPEZ-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(C(=O)NN)cc1OC |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2,4,5-trimethoxybenzenecarbohydrazide |
| 2,3-DIHYDRO-3-METHYL-1,5-BENZODIAZEPIN-4(5H)-ONE |