3-methoxy-2-[(3-methylphenyl)methoxy]benzaldehyde structure
|
Common Name | 3-methoxy-2-[(3-methylphenyl)methoxy]benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 588713-63-7 | Molecular Weight | 256.29600 | |
| Density | 1.133g/cm3 | Boiling Point | 400.7ºC at 760 mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.7ºC | |
| Name | 3-methoxy-2-[(3-methylphenyl)methoxy]benzaldehyde |
|---|
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 400.7ºC at 760 mmHg |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.29600 |
| Flash Point | 187.7ºC |
| Exact Mass | 256.11000 |
| PSA | 35.53000 |
| LogP | 3.39510 |
| Index of Refraction | 1.584 |
| InChIKey | CCUWTZOKQKVRNV-UHFFFAOYSA-N |
| SMILES | COc1cccc(C=O)c1OCc1cccc(C)c1 |
| HS Code | 2912499000 |
|---|
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |