Androst-5-en-16-one, 3.beta.-methoxy- structure
|
Common Name | Androst-5-en-16-one, 3.beta.-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 5888-04-0 | Molecular Weight | 302.45100 | |
| Density | 1.07g/cm3 | Boiling Point | 407.3ºC at 760 mmHg | |
| Molecular Formula | C20H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161ºC | |
| Name | 3-methoxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 407.3ºC at 760 mmHg |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.45100 |
| Flash Point | 161ºC |
| Exact Mass | 302.22500 |
| PSA | 26.30000 |
| LogP | 4.53330 |
| Index of Refraction | 1.536 |
| InChIKey | YWQFPAUGLVZHQW-APNJTCTJSA-N |
| SMILES | COC1CCC2(C)C(=CCC3C4CC(=O)CC4(C)CCC32)C1 |
|
~%
Androst-5-en-16... CAS#:5888-04-0 |
| Literature: Fajkos,J.; Joska,J. Collection of Czechoslovak Chemical Communications, 1961 , vol. 26, p. 1118 - 1136 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 3beta-Methoxy-5-androsten-17-one |
| Androst-5-en-17-one,3-methoxy-,(3beta) |