1-(4-Chlorophenyl)cyclohexanecarboxylic acid structure
|
Common Name | 1-(4-Chlorophenyl)cyclohexanecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 58880-37-8 | Molecular Weight | 238.710 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 378.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C13H15ClO2 | Melting Point | 150-156 °C | |
| MSDS | N/A | Flash Point | 183.0±25.9 °C | |
| Name | 1-(4-Chlorophenyl)-1-cyclohexanecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 378.9±35.0 °C at 760 mmHg |
| Melting Point | 150-156 °C |
| Molecular Formula | C13H15ClO2 |
| Molecular Weight | 238.710 |
| Flash Point | 183.0±25.9 °C |
| Exact Mass | 238.076050 |
| PSA | 37.30000 |
| LogP | 3.84 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | UPNXUJXIIZGXLQ-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(c2ccc(Cl)cc2)CCCCC1 |
|
~%
1-(4-Chlorophen... CAS#:58880-37-8 |
| Literature: Journal of the American Chemical Society, , vol. 68, p. 828,831 |
|
~%
1-(4-Chlorophen... CAS#:58880-37-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 21, # 5 p. 1438 - 1441 |
|
~%
1-(4-Chlorophen... CAS#:58880-37-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 21, # 5 p. 1438 - 1441 |
|
~%
1-(4-Chlorophen... CAS#:58880-37-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 21, # 5 p. 1438 - 1441 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-(4-chlorophenyl)-1-cyclohexanecarboxylic acid |
| EINECS 261-481-2 |
| MFCD00019350 |
| 1-(4-Chlorophenyl)cyclohexanecarboxylic acid |
| Cyclohexanecarboxylic acid, 1-(4-chlorophenyl)- |