1-(4-nitrophenyl)-2-[2-(4-nitrophenyl)-2-oxo-ethyl]sulfanyl-ethanone structure
|
Common Name | 1-(4-nitrophenyl)-2-[2-(4-nitrophenyl)-2-oxo-ethyl]sulfanyl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 58881-57-5 | Molecular Weight | 360.34100 | |
| Density | 1.435g/cm3 | Boiling Point | 566.5ºC at 760 mmHg | |
| Molecular Formula | C16H12N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.4ºC | |
| Name | 1-(4-nitrophenyl)-2-[2-(4-nitrophenyl)-2-oxoethyl]sulfanylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.435g/cm3 |
|---|---|
| Boiling Point | 566.5ºC at 760 mmHg |
| Molecular Formula | C16H12N2O6S |
| Molecular Weight | 360.34100 |
| Flash Point | 296.4ºC |
| Exact Mass | 360.04200 |
| PSA | 151.08000 |
| LogP | 4.34820 |
| Index of Refraction | 1.65 |
| InChIKey | BHHMLQUXGPIROU-UHFFFAOYSA-N |
| SMILES | O=C(CSCC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
|
~%
1-(4-nitropheny... CAS#:58881-57-5 |
| Literature: Miyahara,Y. Journal of Heterocyclic Chemistry, 1979 , vol. 16, p. 1147 - 1151 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| F0300-0186 |
| 1,1'-bis-(4-nitro-phenyl)-2,2'-sulfonyl-bis-ethanone |