2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone
Modify Date: 2025-09-23 21:15:55
2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone structure
|
Common Name | 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 58905-34-3 | Molecular Weight | 297.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H12ClN3O |
|---|---|
| Molecular Weight | 297.74 |
| InChIKey | SSPASMJAZJCYNF-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(c1ccc(Cl)cc1)n1cncn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone? |
| A: SMILES notation of 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone is O=C(c1ccccc1)C(c1ccc(Cl)cc1)n1cncn1. |
| Q: What is the molecular formula of 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone? |
| A: Molecular formula of 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone is C16H12ClN3O. |
| Q: What is the molecular weight of 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone? |
| A: Molecular weight of 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone is 297.74. |
| Q: What is the CAS number of 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone? |
| A: CAS number of 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone is 58905-34-3. |
| Q: What is the InChIKey of 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone? |
| A: InChIKey of 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone is SSPASMJAZJCYNF-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone? |
| A: The English name of 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone is 2-(4-Chlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-1-yl)ethanone. |
| Q: What is the Chinese name of 58905-34-3? |
| A: Chinese name of 58905-34-3 is 58905-34-3. |