coprine structure
|
Common Name | coprine | ||
|---|---|---|---|---|
| CAS Number | 58919-61-2 | Molecular Weight | 202.20800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of coprineCoprine is a mycotoxin isolated from Coprinopsis atramentaria. Coprine is an acetaldehyde dehydrogenase inhibitor that causes the buildup of acetaldehyde, causing the alcohol flushing reaction[1]. |
| Name | coprine |
|---|
| Description | Coprine is a mycotoxin isolated from Coprinopsis atramentaria. Coprine is an acetaldehyde dehydrogenase inhibitor that causes the buildup of acetaldehyde, causing the alcohol flushing reaction[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C8H14N2O4 |
|---|---|
| Molecular Weight | 202.20800 |
| Exact Mass | 202.09500 |
| PSA | 112.65000 |
| InChIKey | OEEZRBUCLFMTLD-YFKPBYRVSA-N |
| SMILES | NC(CCC(=O)NC1(O)CC1)C(=O)O |