Phosphoric acid, 2,2-dichloroethenyl dimethyl ester mixt. with O,O-dimethyl O-[3-methyl-4-(methylthio)phenyl] phosphorothioate structure
|
Common Name | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester mixt. with O,O-dimethyl O-[3-methyl-4-(methylthio)phenyl] phosphorothioate | ||
|---|---|---|---|---|
| CAS Number | 58934-19-3 | Molecular Weight | 499.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22Cl2O7P2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Phosphoric acid, 2,2-dichloroethenyl dimethyl ester mixt. with O,O-dimethyl O-[3-methyl-4-(methylthio)phenyl] phosphorothioate |
|---|
| Molecular Formula | C14H22Cl2O7P2S2 |
|---|---|
| Molecular Weight | 499.3 |
| InChIKey | PPAXRVMVFMSOBZ-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)OC=C(Cl)Cl.COP(=S)(OC)Oc1ccc(SC)c(C)c1 |