9-Methoxy-5-methyl-12-((methylthio)methyl)-6,7,12,13-tetrahydro-5H-(1,3)benzodioxolo(5,6-b)benzo(f)azonin-10-ol structure
|
Common Name | 9-Methoxy-5-methyl-12-((methylthio)methyl)-6,7,12,13-tetrahydro-5H-(1,3)benzodioxolo(5,6-b)benzo(f)azonin-10-ol | ||
|---|---|---|---|---|
| CAS Number | 58939-39-2 | Molecular Weight | 387.49300 | |
| Density | 1.228g/cm3 | Boiling Point | 585.8ºC at 760 mmHg | |
| Molecular Formula | C21H25NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.1ºC | |
| Name | 9-methoxy-5-methyl-12-methylsulfanylmethyl-6,7,12,13-tetrahydro-5H-benzo[f][1,3]dioxolo[4',5':4,5]benzo[1,2-b]azonin-10-ol |
|---|
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 585.8ºC at 760 mmHg |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.49300 |
| Flash Point | 308.1ºC |
| Exact Mass | 387.15000 |
| PSA | 76.46000 |
| LogP | 3.87610 |
| Index of Refraction | 1.6 |
| InChIKey | SHZPKHCRSMQQSP-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1O)C(CSC)Cc1cc3c(cc1N(C)CC2)OCO3 |
|
~%
9-Methoxy-5-met... CAS#:58939-39-2 |
| Literature: Kano,S. et al. Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, p. 310 - 314 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |