2-[5-[4-amino-2-(hydroxymethyl)phenoxy]pentyl]isoindole-1,3-dione
Modify Date: 2025-08-25 19:03:40
![2-[5-[4-amino-2-(hydroxymethyl)phenoxy]pentyl]isoindole-1,3-dione Structure](https://image.chemsrc.com/caspic/373/5896-92-4.png)
2-[5-[4-amino-2-(hydroxymethyl)phenoxy]pentyl]isoindole-1,3-dione structure
|
Common Name | 2-[5-[4-amino-2-(hydroxymethyl)phenoxy]pentyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 5896-92-4 | Molecular Weight | 354.40000 | |
| Density | 1.292g/cm3 | Boiling Point | 583.9ºC at 760 mmHg | |
| Molecular Formula | C20H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.9ºC | |
| Name | 2-[5-[4-amino-2-(hydroxymethyl)phenoxy]pentyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 583.9ºC at 760 mmHg |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.40000 |
| Flash Point | 306.9ºC |
| Exact Mass | 354.15800 |
| PSA | 92.86000 |
| LogP | 3.12550 |
| Index of Refraction | 1.632 |
| InChIKey | PVMHHJDMWPZFBU-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OCCCCCN2C(=O)c3ccccc3C2=O)c(CO)c1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-{5-[4-amino-2-(hydroxymethyl)phenoxy]pentyl}-1H-isoindole-1,3(2H)-dione |
| N-[5-(4-amino-2-hydroxymethyl-phenoxy)-pentyl]-phthalimide |
| B 6354 |
| 1-(4-Amino-2-hydroxymethyl-phenoxy)-5-phthalimido-pentan |