Methyl 5-benzoyl-2-furoate structure
|
Common Name | Methyl 5-benzoyl-2-furoate | ||
|---|---|---|---|---|
| CAS Number | 58972-21-7 | Molecular Weight | 230.216 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 368.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C13H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.7±23.7 °C | |
| Name | Methyl 5-benzoylfuran-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 368.6±27.0 °C at 760 mmHg |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.216 |
| Flash Point | 176.7±23.7 °C |
| Exact Mass | 230.057907 |
| PSA | 56.51000 |
| LogP | 1.86 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | FILYPAWPUAUFFC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)c2ccccc2)o1 |
| HS Code | 2932190090 |
|---|
|
~66%
Methyl 5-benzoy... CAS#:58972-21-7 |
| Literature: Kuo, Sheng-Chu; Lee, Fang-Yu; Teng, Che-Ming; Huang, Li-Jiau; Chou, Li-Chen; Guh, Jih-Hwa; Pan, Shiow-Lin Patent: US2005/215612 A1, 2005 ; Location in patent: Page/Page column 3; 5 ; |
|
~56%
Methyl 5-benzoy... CAS#:58972-21-7 |
| Literature: Ishiyama, Tatsuo; Kizaki, Hiroe; Hayashi, Takahiro; Suzuki, Akira; Miyaura, Norio Journal of Organic Chemistry, 1998 , vol. 63, # 14 p. 4726 - 4731 |
|
~%
Methyl 5-benzoy... CAS#:58972-21-7 |
| Literature: US2010/130556 A1, ; Page/Page column 20 ; |
|
~63%
Methyl 5-benzoy... CAS#:58972-21-7 |
| Literature: Belen'kii; Gromova; Kolotaev; Krayushkin Chemistry of Heterocyclic Compounds, 2000 , vol. 36, # 3 p. 256 - 263 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| methyl-5-benzoyl-2-furancarboxylate |
| 5-methoxycarbonyl-2-furyl phenyl ketone |
| Methyl 5-benzoyl-furan-2-carboxylate |
| 5-benzoyl-furan-2-carboxylic acid methyl ester |
| 5-methoxycarbonyl-2-furanyl phenyl ketone |
| Methyl 5-benzoyl-2-furoate |
| 5-Methoxycarbonyl-furan-2-yl phenyl ketone |
| 2-Furancarboxylic acid, 5-benzoyl-, methyl ester |