5,6,11,12-Naphthacenetetrone,1-(acetyloxy)-1,4,4a,12a-tetrahydro- structure
|
Common Name | 5,6,11,12-Naphthacenetetrone,1-(acetyloxy)-1,4,4a,12a-tetrahydro- | ||
|---|---|---|---|---|
| CAS Number | 58976-82-2 | Molecular Weight | 350.32200 | |
| Density | 1.45g/cm3 | Boiling Point | 517.8ºC at 760mmHg | |
| Molecular Formula | C20H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.4ºC | |
| Name | (5,6,11,12-tetraoxo-1,4,4a,12a-tetrahydrotetracen-1-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 517.8ºC at 760mmHg |
| Molecular Formula | C20H14O6 |
| Molecular Weight | 350.32200 |
| Flash Point | 229.4ºC |
| Exact Mass | 350.07900 |
| PSA | 94.58000 |
| LogP | 1.63800 |
| Index of Refraction | 1.64 |
| InChIKey | ZWBPPZICKXFYCI-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1C=CCC2C(=O)C3=C(C(=O)c4ccccc4C3=O)C(=O)C12 |
|
~%
5,6,11,12-Napht... CAS#:58976-82-2 |
| Literature: Lee; Martinez; Smith; Henry Journal of Organic Chemistry, 1976 , vol. 41, # 13 p. 2296 - 2303 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| 5,6,11,12-tetraoxo-1,4,4a,5,6,11,12,12a-octahydrotetracen-1-yl acetate |