Silane, 1,4-butanediylbis[fluorodimethyl
Modify Date: 2026-07-18 22:43:36
Silane, 1,4-butanediylbis[fluorodimethyl structure
|
Common Name | Silane, 1,4-butanediylbis[fluorodimethyl | ||
|---|---|---|---|---|
| CAS Number | 590-82-9 | Molecular Weight | 210.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H20F2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Silane, 1,4-butanediylbis[fluorodimethyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H20F2Si2 |
|---|---|
| Molecular Weight | 210.41 |
| InChIKey | GWYYWNKVCNKIMF-UHFFFAOYSA-N |
| SMILES | C[Si](C)(F)CCCC[Si](C)(C)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Silane, 1,4-butanediylbis[fluorodimethyl? |
| A: InChIKey of Silane, 1,4-butanediylbis[fluorodimethyl is GWYYWNKVCNKIMF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Silane, 1,4-butanediylbis[fluorodimethyl? |
| A: SMILES notation of Silane, 1,4-butanediylbis[fluorodimethyl is C[Si](C)(F)CCCC[Si](C)(C)F. |
| Q: What is the molecular formula of Silane, 1,4-butanediylbis[fluorodimethyl? |
| A: Molecular formula of Silane, 1,4-butanediylbis[fluorodimethyl is C8H20F2Si2. |
| Q: What is the CAS number of Silane, 1,4-butanediylbis[fluorodimethyl? |
| A: CAS number of Silane, 1,4-butanediylbis[fluorodimethyl is 590-82-9. |
| Q: What is the molecular weight of Silane, 1,4-butanediylbis[fluorodimethyl? |
| A: Molecular weight of Silane, 1,4-butanediylbis[fluorodimethyl is 210.41. |
| Q: What is the Chinese name of 590-82-9? |
| A: Chinese name of 590-82-9 is 590-82-9. |
| Q: What is the English name of Silane, 1,4-butanediylbis[fluorodimethyl? |
| A: The English name of Silane, 1,4-butanediylbis[fluorodimethyl is Silane, 1,4-butanediylbis[fluorodimethyl. |