1,1,1-Trichloro-2,2-bis(4-ethylphenyl)ethane structure
|
Common Name | 1,1,1-Trichloro-2,2-bis(4-ethylphenyl)ethane | ||
|---|---|---|---|---|
| CAS Number | 5902-61-4 | Molecular Weight | 341.70200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19Cl3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-ethyl-4-[2,2,2-trichloro-1-(4-ethylphenyl)ethyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H19Cl3 |
|---|---|
| Molecular Weight | 341.70200 |
| Exact Mass | 340.05500 |
| LogP | 6.31350 |
| InChIKey | OUBPMUQDBPYZQG-UHFFFAOYSA-N |
| SMILES | CCc1ccc(C(c2ccc(CC)cc2)C(Cl)(Cl)Cl)cc1 |
|
~%
1,1,1-Trichloro... CAS#:5902-61-4 |
| Literature: Stephenson; Waters Journal of the Chemical Society, 1946 , p. 339,342 |
| 1,1,1-TRICHLORO-2,2-BIS(PARA-ETHYLPHENYL)ETHANE |
| 1,1,1-Trichloro-2,2-bis-(p-aethylphenyl)aethan |
| Benzene,1,1'-(2,2,2-trichloroethylidene)bis[4-ethyl |
| 2,2-bis-(4-ethyl-phenyl)-1,1,1-trichloro-ethane |
| 2,2-Bis-(4-aethyl-phenyl)-1,1,1-trichlor-aethan |