Naphthalene, 1-fluoro-5-(trimethylsilyl)
Modify Date: 2025-08-23 07:51:04
Naphthalene, 1-fluoro-5-(trimethylsilyl) structure
|
Common Name | Naphthalene, 1-fluoro-5-(trimethylsilyl) | ||
|---|---|---|---|---|
| CAS Number | 59080-28-3 | Molecular Weight | 218.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15FSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Naphthalene, 1-fluoro-5-(trimethylsilyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15FSi |
|---|---|
| Molecular Weight | 218.34 |
| InChIKey | NEOBHJWEGYSLRL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1cccc2c(F)cccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Naphthalene, 1-fluoro-5-(trimethylsilyl)? |
| A: SMILES notation of Naphthalene, 1-fluoro-5-(trimethylsilyl) is C[Si](C)(C)c1cccc2c(F)cccc12. |
| Q: What is the molecular formula of Naphthalene, 1-fluoro-5-(trimethylsilyl)? |
| A: Molecular formula of Naphthalene, 1-fluoro-5-(trimethylsilyl) is C13H15FSi. |
| Q: What is the InChIKey of Naphthalene, 1-fluoro-5-(trimethylsilyl)? |
| A: InChIKey of Naphthalene, 1-fluoro-5-(trimethylsilyl) is NEOBHJWEGYSLRL-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 59080-28-3? |
| A: Chinese name of 59080-28-3 is 59080-28-3. |
| Q: What is the molecular weight of Naphthalene, 1-fluoro-5-(trimethylsilyl)? |
| A: Molecular weight of Naphthalene, 1-fluoro-5-(trimethylsilyl) is 218.34. |
| Q: What is the CAS number of Naphthalene, 1-fluoro-5-(trimethylsilyl)? |
| A: CAS number of Naphthalene, 1-fluoro-5-(trimethylsilyl) is 59080-28-3. |
| Q: What is the English name of Naphthalene, 1-fluoro-5-(trimethylsilyl)? |
| A: The English name of Naphthalene, 1-fluoro-5-(trimethylsilyl) is Naphthalene, 1-fluoro-5-(trimethylsilyl). |