2,4',5-Tribromobiphenyl structure
|
Common Name | 2,4',5-Tribromobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 59080-36-3 | Molecular Weight | 390.896 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 377.5±27.0 °C at 760 mmHg | |
| Molecular Formula | C12H7Br3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.9±18.5 °C | |
| Name | 1,4-dibromo-2-(4-bromophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.5±27.0 °C at 760 mmHg |
| Molecular Formula | C12H7Br3 |
| Molecular Weight | 390.896 |
| Flash Point | 176.9±18.5 °C |
| Exact Mass | 387.809753 |
| LogP | 6.15 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | VQAOFEQEGKHRBC-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2cc(Br)ccc2Br)cc1 |
|
~%
2,4',5-Tribromo... CAS#:59080-36-3 |
| Literature: Case Journal of the American Chemical Society, 1939 , vol. 61, p. 3487,3489 |
|
~%
2,4',5-Tribromo... CAS#:59080-36-3 |
| Literature: Bellavita Gazzetta Chimica Italiana, 1935 , vol. 65, p. 632,643 |
| 2,4',5-Tribromobiphenyl |
| 1,1'-Biphenyl,2,4',5-tribromo |
| 2,3,4,4 |
| PBB 31 |
| 2,5,4'-tribromo-biphenyl |
| 2,5,4'-Tribrom-biphenyl |
| 2,4',5-Tribromo-1,1'-biphenyl |