2,4',5-Tribromobiphenyl
2,4',5-Tribromobiphenyl structure
|
Common Name | 2,4',5-Tribromobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 59080-36-3 | Molecular Weight | 390.896 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 377.5±27.0 °C at 760 mmHg | |
| Molecular Formula | C12H7Br3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.9±18.5 °C | |
Summary: 2,4',5-Tribromobiphenyl (1,4-Dibromo-2-(4-bromo-phenyl)benzene), CAS号 59080-36-3, molecular formula C12H7Br3, molecular weight 390.896, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-dibromo-2-(4-bromophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.5±27.0 °C at 760 mmHg |
| Molecular Formula | C12H7Br3 |
| Molecular Weight | 390.896 |
| Flash Point | 176.9±18.5 °C |
| Exact Mass | 387.809753 |
| LogP | 6.15 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | VQAOFEQEGKHRBC-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2cc(Br)ccc2Br)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,4',5-Tribromo... CAS#:59080-36-3 |
| Literature: Case Journal of the American Chemical Society, 1939 , vol. 61, p. 3487,3489 |
|
~%
2,4',5-Tribromo... CAS#:59080-36-3 |
| Literature: Bellavita Gazzetta Chimica Italiana, 1935 , vol. 65, p. 632,643 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4',5-Tribromobiphenyl |
| 1,1'-Biphenyl,2,4',5-tribromo |
| 2,3,4,4 |
| PBB 31 |
| 2,5,4'-tribromo-biphenyl |
| 2,5,4'-Tribrom-biphenyl |
| 2,4',5-Tribromo-1,1'-biphenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1,4-dibromo-2-(4-bromophenyl)benzene? |
| A: CAS number of 1,4-dibromo-2-(4-bromophenyl)benzene is 59080-36-3. |
| Q: What is the English name of 1,4-dibromo-2-(4-bromophenyl)benzene? |
| A: The English name of 1,4-dibromo-2-(4-bromophenyl)benzene is 1,4-dibromo-2-(4-bromophenyl)benzene. |
| Q: What is the boiling point of 1,4-dibromo-2-(4-bromophenyl)benzene? |
| A: Boiling point of 1,4-dibromo-2-(4-bromophenyl)benzene is 377.5±27.0 °C at 760 mmHg. |
| Q: What English synonyms does 1,4-dibromo-2-(4-bromophenyl)benzene have? |
| A: English synonyms of 1,4-dibromo-2-(4-bromophenyl)benzene: 2,4',5-Tribromobiphenyl, 1,1'-Biphenyl,2,4',5-tribromo, 2,3,4,4, PBB 31, 2,5,4'-tribromo-biphenyl, 2,5,4'-Tribrom-biphenyl, 2,4',5-Tribromo-1,1'-biphenyl. |
| Q: What is the InChIKey of 1,4-dibromo-2-(4-bromophenyl)benzene? |
| A: InChIKey of 1,4-dibromo-2-(4-bromophenyl)benzene is VQAOFEQEGKHRBC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1,4-dibromo-2-(4-bromophenyl)benzene? |
| A: SMILES notation of 1,4-dibromo-2-(4-bromophenyl)benzene is Brc1ccc(-c2cc(Br)ccc2Br)cc1. |
| Q: What is the molecular formula of 1,4-dibromo-2-(4-bromophenyl)benzene? |
| A: Molecular formula of 1,4-dibromo-2-(4-bromophenyl)benzene is C12H7Br3. |
| Q: What is the LogP of 1,4-dibromo-2-(4-bromophenyl)benzene? |
| A: LogP of 1,4-dibromo-2-(4-bromophenyl)benzene is 6.15. |
| Q: What is the molecular weight of 1,4-dibromo-2-(4-bromophenyl)benzene? |
| A: Molecular weight of 1,4-dibromo-2-(4-bromophenyl)benzene is 390.896. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |