isoathyriol structure
|
Common Name | isoathyriol | ||
|---|---|---|---|---|
| CAS Number | 59092-97-6 | Molecular Weight | 274.22600 | |
| Density | 1.586g/cm3 | Boiling Point | 588.1ºC at 760 mmHg | |
| Molecular Formula | C14H10O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.1ºC | |
| Name | isoathyriol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.586g/cm3 |
|---|---|
| Boiling Point | 588.1ºC at 760 mmHg |
| Molecular Formula | C14H10O6 |
| Molecular Weight | 274.22600 |
| Flash Point | 231.1ºC |
| Exact Mass | 274.04800 |
| PSA | 100.13000 |
| LogP | 2.07160 |
| Index of Refraction | 1.714 |
| InChIKey | DHIJSMOHBJPOJU-UHFFFAOYSA-N |
| SMILES | COc1cc2oc3cc(O)cc(O)c3c(=O)c2cc1O |
|
~%
isoathyriol CAS#:59092-97-6 |
| Literature: Yates; Stout Journal of the American Chemical Society, 1958 , vol. 80, p. 1691,1699 |
|
~%
isoathyriol CAS#:59092-97-6 |
| Literature: Yates; Stout Journal of the American Chemical Society, 1958 , vol. 80, p. 1691,1699 |
| 6-Methoxy-1,3,7-trihydroxyxanthone |
| Isoathyriol |
| 1,3,7-Trihydroxy-6-methoxy-xanthen-9-on |
| 1,3,7-trihydroxy-6-methoxyxanthone |
| 1,3,7-trihydroxy-6-methoxy-xanthen-9-one |
| 1,3,7-trihydroxy-6-methoxyxanthen-9-one |