N-(4-fluorophenyl)-2-[4-[[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]phenyl]acetamide
Modify Date: 2025-10-25 07:04:32
![N-(4-fluorophenyl)-2-[4-[[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]phenyl]acetamide Structure](https://image.chemsrc.com/caspic/132/5912-24-3.png)
N-(4-fluorophenyl)-2-[4-[[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]phenyl]acetamide structure
|
Common Name | N-(4-fluorophenyl)-2-[4-[[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5912-24-3 | Molecular Weight | 437.46200 | |
| Density | 1.377g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H17F2N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-fluorophenyl)-2-[4-[[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]oxy]phenyl]acetamide |
|---|
| Density | 1.377g/cm3 |
|---|---|
| Molecular Formula | C23H17F2N3O2S |
| Molecular Weight | 437.46200 |
| Exact Mass | 437.10100 |
| PSA | 92.35000 |
| LogP | 5.45360 |
| Index of Refraction | 1.646 |
| InChIKey | CVDQCVAFZZRVSX-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccc(Oc2nc(Cc3ccc(F)cc3)ns2)cc1)Nc1ccc(F)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |