(1-((4-Fluorophenyl)sulfonyl)piperidin-4-yl)(4-phenylpiperazin-1-yl)methanone
Modify Date: 2026-04-05 10:22:14
(1-((4-Fluorophenyl)sulfonyl)piperidin-4-yl)(4-phenylpiperazin-1-yl)methanone structure
|
Common Name | (1-((4-Fluorophenyl)sulfonyl)piperidin-4-yl)(4-phenylpiperazin-1-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 591237-99-9 | Molecular Weight | 431.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H26FN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-((4-Fluorophenyl)sulfonyl)piperidin-4-yl)(4-phenylpiperazin-1-yl)methanone |
|---|
| Molecular Formula | C22H26FN3O3S |
|---|---|
| Molecular Weight | 431.5 |
| InChIKey | MQHZMMQJMHOWIX-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)N2CCN(CC2)C3=CC=CC=C3)S(=O)(=O)C4=CC=C(C=C4)F |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
Total 4, Current Page 1 of 1
1