N-benzyl-N'-(2-fluorophenyl)oxamide structure
|
Common Name | N-benzyl-N'-(2-fluorophenyl)oxamide | ||
|---|---|---|---|---|
| CAS Number | 5917-65-7 | Molecular Weight | 272.27400 | |
| Density | 1.297g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H13FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-benzyl-N'-(2-fluorophenyl)oxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.297g/cm3 |
|---|---|
| Molecular Formula | C15H13FN2O2 |
| Molecular Weight | 272.27400 |
| Exact Mass | 272.09600 |
| PSA | 58.20000 |
| LogP | 2.54450 |
| Index of Refraction | 1.615 |
| InChIKey | AESGMQYRVTZACO-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccccc1)C(=O)Nc1ccccc1F |
|
~88%
N-benzyl-N'-(2-... CAS#:5917-65-7 |
| Literature: United States of America as represented by the Secretary of the Air Force Patent: US4594430 A1, 1986 ; |
| 2,2-dinitropropyl methyl ether |
| 1-methoxy-2,2-dinitro-propane |
| N-benzyl-N'-(2-fluorophenyl)ethanediamide |
| 2.2-Dinitropropyl-methylaether |