ZL-Arg-pNA * HCl
ZL-Arg-pNA * HCl structure
|
Common Name | ZL-Arg-pNA * HCl | ||
|---|---|---|---|---|
| CAS Number | 59188-53-3 | Molecular Weight | 464.903 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H25ClN6O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Z-L-Arg-pNA * HCl (CAS: 59188-53-3), molecular formula C20H25ClN6O5, molecular weight 464.903. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H25ClN6O5 |
|---|---|
| Molecular Weight | 464.903 |
| Exact Mass | 464.157501 |
| PSA | 175.15000 |
| LogP | 5.07160 |
| InChIKey | YODAFEYYSLICID-LMOVPXPDSA-N |
| SMILES | Cl.NC(N)=NCCCC(NC(=O)OCc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~94%
ZL-Arg-pNA * HCl CAS#:59188-53-3 |
| Literature: Rijkers, Dirk T. S.; Adams, Hans P. H. M.; Hemker, H. Coenraad; Tesser, Godefridus I. Tetrahedron, 1995 , vol. 51, # 41 p. 11235 - 11250 |
|
~94%
ZL-Arg-pNA * HCl CAS#:59188-53-3 |
| Literature: Oyamada, Hidekazu; Saito, Takashi; Inaba, Shinsaku; Ueki, Masaaki Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 4 p. 1422 - 1424 |
|
~97%
ZL-Arg-pNA * HCl CAS#:59188-53-3 |
| Literature: Rijkers, D. T. S.; Hemker, H. C.; Nefkens, G. H. L.; Tesser, G. I. Recueil des Travaux Chimiques des Pays-Bas, 1991 , vol. 110, # 7-8 p. 347 - 348 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Z-L-ARGININE P-NITROANILIDE HYDROCHLORIDE |
| Z-Arg-pNA*HCl |
| Z-ARGININE-PNA HCL |
| Carbamic acid, N-[(1S)-4-[(aminoiminomethyl)amino]-1-[[(4-nitrophenyl)amino]carbonyl]butyl]-, phenylmethyl ester, hydrochloride (1:1) |
| Z-L-ARGININE-4-NITROANILIDE HYDROCHLORIDE |
| L-ZAPA |
| Z-L-ARG-PNA HCL |
| N-[(Benzyloxy)carbonyl]-N-(4-nitrophenyl)argininamide hydrochloride (1:1) |
| N-A-cbz-L-arginine P-nitroanilide*hydrochloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride? |
| A: CAS number of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride is 59188-53-3. |
| Q: What is the InChIKey of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride? |
| A: InChIKey of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride is YODAFEYYSLICID-LMOVPXPDSA-N. |
| Q: What is the LogP of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride? |
| A: LogP of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride is 5.07160. |
| Q: What are the upstream materials of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride? |
| A: Related upstream materials(CAS) of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride: 56672-63-0;100-01-6;134393-23-0;1234-35-1. |
| Q: What is the polar surface area (PSA) of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride? |
| A: Polar surface area (PSA) of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride is 175.15000. |
| Q: What is the molecular formula of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride? |
| A: Molecular formula of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride is C20H25ClN6O5. |
| Q: What is the English name of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride? |
| A: The English name of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride is benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride. |
| Q: What is the molecular weight of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride? |
| A: Molecular weight of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride is 464.903. |
| Q: What is the SMILES notation of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride? |
| A: SMILES notation of benzyl N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]carbamate,hydrochloride is Cl.NC(N)=NCCCC(NC(=O)OCc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1. |