N-(2-cyanophenyl)-2-[3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide structure
|
Common Name | N-(2-cyanophenyl)-2-[3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5920-72-9 | Molecular Weight | 391.36700 | |
| Density | 1.49g/cm3 | Boiling Point | 637.5ºC at 760 mmHg | |
| Molecular Formula | C18H12F3N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 339.4ºC | |
| Name | N-(2-cyanophenyl)-2-[3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 637.5ºC at 760 mmHg |
| Molecular Formula | C18H12F3N3O2S |
| Molecular Weight | 391.36700 |
| Flash Point | 339.4ºC |
| Exact Mass | 391.06000 |
| PSA | 114.27000 |
| LogP | 4.75328 |
| Index of Refraction | 1.631 |
| InChIKey | QVDBAZSMFIPLAN-UHFFFAOYSA-N |
| SMILES | N#Cc1ccccc1NC(=O)CC1Sc2ccc(C(F)(F)F)cc2NC1=O |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| CCG-3553 |
| F1065-0506 |
| 5-Phenyl-1-pikryl-pyrazolin |
| 5-phenyl-1-(2,4,6-trinitro-phenyl)-4,5-dihydro-1H-pyrazole |