2-Butenoic acid,4-[(4-bromophenyl)amino]-4-oxo-, (2Z)- structure
|
Common Name | 2-Butenoic acid,4-[(4-bromophenyl)amino]-4-oxo-, (2Z)- | ||
|---|---|---|---|---|
| CAS Number | 59256-47-2 | Molecular Weight | 270.07900 | |
| Density | 1.688g/cm3 | Boiling Point | 482ºC at 760 mmHg | |
| Molecular Formula | C10H8BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.3ºC | |
| Name | (Z)-4-(4-bromoanilino)-4-oxobut-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.688g/cm3 |
|---|---|
| Boiling Point | 482ºC at 760 mmHg |
| Molecular Formula | C10H8BrNO3 |
| Molecular Weight | 270.07900 |
| Flash Point | 245.3ºC |
| Exact Mass | 268.96900 |
| PSA | 66.40000 |
| LogP | 2.10140 |
| Index of Refraction | 1.66 |
| InChIKey | DSNFUZCLEZJCRN-WAYWQWQTSA-N |
| SMILES | O=C(O)C=CC(=O)Nc1ccc(Br)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(p-Bromophenyl)-maleamic saeure |
| p-bromo maleanilic acid |
| N-(p-bromophenyl)maleamic acid |
| 4-bromomaleanilic acid |
| 2-Butenoic acid,4-[(4-bromophenyl)amino]-4-oxo,(Z) |
| Maleinsaeure-mono-p-bromphenylamid |
| 3-[(4-bromophenyl)carbamoyl]prop-2-enoic acid |