2,2',4,4',6,6'-HEXABROMOBIPHENYL structure
|
Common Name | 2,2',4,4',6,6'-HEXABROMOBIPHENYL | ||
|---|---|---|---|---|
| CAS Number | 59261-08-4 | Molecular Weight | 627.584 | |
| Density | 2.5±0.1 g/cm3 | Boiling Point | 458.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H4Br6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.8±22.1 °C | |
| Name | 2,2',4,4',6,6'-Hexabromobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 2.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 458.3±40.0 °C at 760 mmHg |
| Molecular Formula | C12H4Br6 |
| Molecular Weight | 627.584 |
| Flash Point | 222.8±22.1 °C |
| Exact Mass | 621.541260 |
| LogP | 7.78 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.697 |
| InChIKey | LNFYSRMCCKKDEH-UHFFFAOYSA-N |
| SMILES | Brc1cc(Br)c(-c2c(Br)cc(Br)cc2Br)c(Br)c1 |
|
~59%
2,2',4,4',6,6'-... CAS#:59261-08-4 |
| Literature: Graff, Julien; Debande, Thibaut; Praz, Jezabel; Guenee, Laure; Alexakis, Alexandre Organic Letters, 2013 , vol. 15, # 16 p. 4270 - 4273 |
|
~%
2,2',4,4',6,6'-... CAS#:59261-08-4 |
| Literature: Australian Journal of Chemistry, , vol. 38, # 3 p. 391 - 399 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1'-Biphenyl, 2,2',4,4',6,6'-hexabromo- |
| 2,2',4,4',6,6'-HEXABROMOBIPHENYL |
| 2,2',4,4',6,6'-Hexabromo-1,1'-biphenyl |
| 1,3,5-tribromo-2-(2,4,6-tribromophenyl)benzene |