ethyl-(4-methylphenoxy)-bis(2-methylpropyl)silane structure
|
Common Name | ethyl-(4-methylphenoxy)-bis(2-methylpropyl)silane | ||
|---|---|---|---|---|
| CAS Number | 59280-42-1 | Molecular Weight | 278.50500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H30OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl-(4-methylphenoxy)-bis(2-methylpropyl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H30OSi |
|---|---|
| Molecular Weight | 278.50500 |
| Exact Mass | 278.20700 |
| PSA | 9.23000 |
| LogP | 5.65120 |
| InChIKey | JXSBDVRAYOAXNN-UHFFFAOYSA-N |
| SMILES | CC[Si](CC(C)C)(CC(C)C)Oc1ccc(C)cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Silane,ethyl(4-methylphenoxy)bis(2-methylpropyl) |