2-(4-bromo-2-fluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione structure
|
Common Name | 2-(4-bromo-2-fluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 59280-73-8 | Molecular Weight | 324.14500 | |
| Density | 1.66g/cm3 | Boiling Point | 433ºC at 760 mmHg | |
| Molecular Formula | C14H11BrFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.7ºC | |
| Name | 2-(4-bromo-2-fluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66g/cm3 |
|---|---|
| Boiling Point | 433ºC at 760 mmHg |
| Molecular Formula | C14H11BrFNO2 |
| Molecular Weight | 324.14500 |
| Flash Point | 215.7ºC |
| Exact Mass | 322.99600 |
| PSA | 37.38000 |
| LogP | 3.39700 |
| Index of Refraction | 1.649 |
| InChIKey | FEKZFMLSOJNBHB-UHFFFAOYSA-N |
| SMILES | O=C1C2=C(CCCC2)C(=O)N1c1ccc(Br)cc1F |
| HS Code | 2925190090 |
|---|
|
~%
2-(4-bromo-2-fl... CAS#:59280-73-8 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4001272 A1, 1977 ; |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(4-bromo-2-fluorophenyl)-4,5,6,7-tetrahydro-2H-isoindole-1,3-dione |
| 2-(4-bromo-2-fluorophenyl)-4,5,6,7-tetrahydro-1h-isoindole-1,3(2h)-dione |
| 2-(4-bromo-2-fluoro-phenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione |