2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione
2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione structure
|
Common Name | 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 59280-75-0 | Molecular Weight | 281.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H10F3NO2 |
|---|---|
| Molecular Weight | 281.23000 |
| Exact Mass | 281.06600 |
| PSA | 37.38000 |
| LogP | 2.91270 |
| InChIKey | CGNDKGLHBJCRHZ-UHFFFAOYSA-N |
| SMILES | O=C1C2=C(CCCC2)C(=O)N1c1c(F)cc(F)cc1F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2925190090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(2,4,6-triflu... CAS#:59280-75-0 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4001272 A1, 1977 ; |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Isoindole-1,3(2H)-dione,4,5,6,7-tetrahydro-2-(2,4,6-trifluorophenyl) |
| 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydro-2H-isoindole-1,3-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione? |
| A: CAS number of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione is 59280-75-0. |
| Q: What English synonyms does 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione have? |
| A: English synonyms of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione: 1H-Isoindole-1,3(2H)-dione,4,5,6,7-tetrahydro-2-(2,4,6-trifluorophenyl), 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydro-2H-isoindole-1,3-dione. |
| Q: What is the molecular formula of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione? |
| A: Molecular formula of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione is C14H10F3NO2. |
| Q: What is the molecular weight of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione? |
| A: Molecular weight of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione is 281.23000. |
| Q: What is the LogP of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione? |
| A: LogP of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione is 2.91270. |
| Q: What is the English name of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione? |
| A: The English name of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione is 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione. |
| Q: What is the SMILES notation of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione? |
| A: SMILES notation of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione is O=C1C2=C(CCCC2)C(=O)N1c1c(F)cc(F)cc1F. |
| Q: What is the Chinese name of 59280-75-0? |
| A: Chinese name of 59280-75-0 is 59280-75-0. |
| Q: What is the polar surface area (PSA) of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione? |
| A: Polar surface area (PSA) of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione is 37.38000. |
| Q: What is the InChIKey of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione? |
| A: InChIKey of 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione is CGNDKGLHBJCRHZ-UHFFFAOYSA-N. |