5-(3-Methylphenyl)-4H-1,2,4-triazol-3-amine structure
|
Common Name | 5-(3-Methylphenyl)-4H-1,2,4-triazol-3-amine | ||
|---|---|---|---|---|
| CAS Number | 59301-24-5 | Molecular Weight | 174.20200 | |
| Density | 1.261 | Boiling Point | 428.7ºC at 760 mmHg | |
| Molecular Formula | C9H10N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.9ºC | |
| Name | 5-(3-methylphenyl)-1H-1,2,4-triazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261 |
|---|---|
| Boiling Point | 428.7ºC at 760 mmHg |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.20200 |
| Flash Point | 242.9ºC |
| Exact Mass | 174.09100 |
| PSA | 67.59000 |
| LogP | 1.94350 |
| Index of Refraction | 1.652 |
| InChIKey | DTWHVCOHVMHZSC-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-c2nc(N)n[nH]2)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Amino-5-m-tolyl-1,2,4-triazol |
| 5-m-tolyl-1H-[1,2,4]triazol-3-ylamine |
| 5(3)-(3-Phenylmethyl)-3(5)amino-1,2,4-triazol |
| 3-amino-5-(m-tolyl)-1,2,4-triazole |
| 5-(3-Methylphenyl)-4H-1,2,4-triazol-3-amine |