4-(2-aminoethylamino)-3-nitrobenzoic acid
Modify Date: 2025-11-25 07:35:59
4-(2-aminoethylamino)-3-nitrobenzoic acid structure
|
Common Name | 4-(2-aminoethylamino)-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 59320-41-1 | Molecular Weight | 225.20100 | |
| Density | 1.467g/cm3 | Boiling Point | 466ºC at 760 mmHg | |
| Molecular Formula | C9H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.6ºC | |
| Name | 4-(2-aminoethylamino)-3-nitrobenzoic acid |
|---|
| Density | 1.467g/cm3 |
|---|---|
| Boiling Point | 466ºC at 760 mmHg |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20100 |
| Flash Point | 235.6ºC |
| Exact Mass | 225.07500 |
| PSA | 121.17000 |
| LogP | 1.96010 |
| Index of Refraction | 1.672 |
| InChIKey | UFDQDPCNAIIBSP-UHFFFAOYSA-N |
| SMILES | NCCNc1ccc(C(=O)O)cc1[N+](=O)[O-] |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |