1-(2,6-dimethoxybenzoyl)piperidine-4-carboxylic acid
Modify Date: 2025-08-25 18:50:47
1-(2,6-dimethoxybenzoyl)piperidine-4-carboxylic acid structure
|
Common Name | 1-(2,6-dimethoxybenzoyl)piperidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 593261-82-6 | Molecular Weight | 293.31500 | |
| Density | 1.249g/cm3 | Boiling Point | 525.6ºC at 760 mmHg | |
| Molecular Formula | C15H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.7ºC | |
| Name | 1-(2,6-dimethoxybenzoyl)piperidine-4-carboxylic acid |
|---|
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 525.6ºC at 760 mmHg |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.31500 |
| Flash Point | 271.7ºC |
| Exact Mass | 293.12600 |
| PSA | 76.07000 |
| LogP | 1.57850 |
| Index of Refraction | 1.558 |
| InChIKey | DJOFYKQPCZGBJX-UHFFFAOYSA-N |
| SMILES | COc1cccc(OC)c1C(=O)N1CCC(C(=O)O)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |