1-(4-tert-butylbenzoyl)piperidine-4-carboxylic acid structure
|
Common Name | 1-(4-tert-butylbenzoyl)piperidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 593261-87-1 | Molecular Weight | 289.36900 | |
| Density | 1.141g/cm3 | Boiling Point | 471.9ºC at 760 mmHg | |
| Molecular Formula | C17H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.2ºC | |
| Name | 1-(4-tert-butylbenzoyl)piperidine-4-carboxylic acid |
|---|
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 471.9ºC at 760 mmHg |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.36900 |
| Flash Point | 239.2ºC |
| Exact Mass | 289.16800 |
| PSA | 57.61000 |
| LogP | 2.85880 |
| Index of Refraction | 1.55 |
| InChIKey | BJBSXVBIXHZPGO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCC(C(=O)O)CC2)cc1 |
| HS Code | 2933399090 |
|---|
|
~95%
1-(4-tert-butyl... CAS#:593261-87-1 |
| Literature: GLAXO GROUP LIMITED Patent: WO2005/58882 A1, 2005 ; Location in patent: Page/Page column 37 ; WO 2005/058882 A1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |