5-amino-3-methylsulfanyl-1-phenylpyrazole-4-carbonitrile structure
|
Common Name | 5-amino-3-methylsulfanyl-1-phenylpyrazole-4-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 59334-11-1 | Molecular Weight | 230.28900 | |
| Density | 1.31g/cm3 | Boiling Point | 454.1ºC at 760 mmHg | |
| Molecular Formula | C11H10N4S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 228.4ºC | |
| Name | 5-amino-3-methylsulfanyl-1-phenylpyrazole-4-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 454.1ºC at 760 mmHg |
| Molecular Formula | C11H10N4S |
| Molecular Weight | 230.28900 |
| Flash Point | 228.4ºC |
| Exact Mass | 230.06300 |
| PSA | 92.93000 |
| LogP | 2.62928 |
| Index of Refraction | 1.684 |
| InChIKey | IIOQJYJHSDCILE-UHFFFAOYSA-N |
| SMILES | CSc1nn(-c2ccccc2)c(N)c1C#N |
| HS Code | 2933199090 |
|---|
|
~93%
5-amino-3-methy... CAS#:59334-11-1 |
| Literature: KYOWA MEDEX CO., LTD. Patent: EP745684 A1, 1996 ; |
|
~96%
5-amino-3-methy... CAS#:59334-11-1 |
| Literature: Tominaga; Honkawa; Hara; Hosomi Journal of Heterocyclic Chemistry, 1990 , vol. 27, # 3 p. 775 - 783 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-amino-3-methylsulfanyl-1-phenyl-1H-pyrazole-4-carbonitrile |
| 5-amino-4-cyano-3-methylsulfanyl-1-phenyl-1H-pyrazole |
| 5-amino-3-methylthio-1-phenylpyrazole-4-carbonitrile |
| 5-amino-3-(methylthio)-1-phenyl-1H-pyrazole-4-carbonitrile |
| 1h-pyrazole-4-carbonitrile,5-amino-3-(methylthio)-1-phenyl |
| 5-amino-4-cyano-3-methylthio-1-phenylpyrazole |