(carboxymethyl)trimethylammonium bromide
(carboxymethyl)trimethylammonium bromide structure
|
Common Name | (carboxymethyl)trimethylammonium bromide | ||
|---|---|---|---|---|
| CAS Number | 5938-06-7 | Molecular Weight | 198.05800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H12BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | carboxymethyl(trimethyl)azanium,bromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H12BrNO2 |
|---|---|
| Molecular Weight | 198.05800 |
| Exact Mass | 197.00500 |
| PSA | 40.13000 |
| InChIKey | ZCCXZMHMPCCJIG-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CC(=O)O.[Br-] |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Betainhydrobromid |
| (Carboxymethyl)trimethylammonium bromide |
| carboxymethyl(trimethyl)azanium bromide |
| betainium bromide |
| betaine hydrobromide |
| Trimethylammonioessigsaeure |
| EINECS 227-695-5 |
| Carboxymethyl-trimethyl-ammonium,Bromid |
| [Me3NCH2COOH]Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 5938-06-7? |
| A: Chinese name of 5938-06-7 is 5938-06-7. |
| Q: What is the InChIKey of carboxymethyl(trimethyl)azanium,bromide? |
| A: InChIKey of carboxymethyl(trimethyl)azanium,bromide is ZCCXZMHMPCCJIG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of carboxymethyl(trimethyl)azanium,bromide? |
| A: Molecular formula of carboxymethyl(trimethyl)azanium,bromide is C5H12BrNO2. |
| Q: What is the polar surface area (PSA) of carboxymethyl(trimethyl)azanium,bromide? |
| A: Polar surface area (PSA) of carboxymethyl(trimethyl)azanium,bromide is 40.13000. |
| Q: What is the English name of carboxymethyl(trimethyl)azanium,bromide? |
| A: The English name of carboxymethyl(trimethyl)azanium,bromide is carboxymethyl(trimethyl)azanium,bromide. |
| Q: What is the CAS number of carboxymethyl(trimethyl)azanium,bromide? |
| A: CAS number of carboxymethyl(trimethyl)azanium,bromide is 5938-06-7. |
| Q: What English synonyms does carboxymethyl(trimethyl)azanium,bromide have? |
| A: English synonyms of carboxymethyl(trimethyl)azanium,bromide: Betainhydrobromid, (Carboxymethyl)trimethylammonium bromide, carboxymethyl(trimethyl)azanium bromide, betainium bromide, betaine hydrobromide, Trimethylammonioessigsaeure, EINECS 227-695-5, Carboxymethyl-trimethyl-ammonium,Bromid, [Me3NCH2COOH]Br. |
| Q: What is the molecular weight of carboxymethyl(trimethyl)azanium,bromide? |
| A: Molecular weight of carboxymethyl(trimethyl)azanium,bromide is 198.05800. |
| Q: What is the SMILES notation of carboxymethyl(trimethyl)azanium,bromide? |
| A: SMILES notation of carboxymethyl(trimethyl)azanium,bromide is C[N+](C)(C)CC(=O)O.[Br-]. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |