N-[4-(benzylideneamino)piperazin-1-yl]-1-phenyl-methanimine structure
|
Common Name | N-[4-(benzylideneamino)piperazin-1-yl]-1-phenyl-methanimine | ||
|---|---|---|---|---|
| CAS Number | 59417-03-7 | Molecular Weight | 292.37800 | |
| Density | 1.09g/cm3 | Boiling Point | 507.2ºC at 760 mmHg | |
| Molecular Formula | C18H20N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.6ºC | |
| Name | N-[4-(benzylideneamino)piperazin-1-yl]-1-phenylmethanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 507.2ºC at 760 mmHg |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.37800 |
| Flash Point | 260.6ºC |
| Exact Mass | 292.16900 |
| PSA | 31.20000 |
| LogP | 2.54800 |
| Index of Refraction | 1.602 |
| InChIKey | YXFDPIAJDPXNIK-MXWIWYRXSA-N |
| SMILES | C(=NN1CCN(N=Cc2ccccc2)CC1)c1ccccc1 |
| HS Code | 2933599090 |
|---|
|
~%
N-[4-(benzylide... CAS#:59417-03-7 |
| Literature: Schmidt; Wichmann Chemische Berichte, 1891 , vol. 24, p. 3245 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4-Bis-benzylidenamino-piperazin |
| N-[4-(BENZYLIDENEAMINO)PIPERAZIN-1-YL]-1-PHENYL-METHANIMINE |
| 1,4-Bis-(benzalamino)piperazin |
| N,N'-dibenzylidene-piperazine-1,4-diamine |
| 1,4-bis-benzylidenamino-piperazine |