benzyl 3,4-diethyl-5-methyl-1H-pyrrole-2-carboxylate structure
|
Common Name | benzyl 3,4-diethyl-5-methyl-1H-pyrrole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 59435-27-7 | Molecular Weight | 271.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl 3,4-diethyl-5-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H21NO2 |
|---|---|
| Molecular Weight | 271.35400 |
| Exact Mass | 271.15700 |
| PSA | 42.09000 |
| LogP | 3.80490 |
| InChIKey | YBVIFLSWQYYIEQ-UHFFFAOYSA-N |
| SMILES | CCc1c(C)[nH]c(C(=O)OCc2ccccc2)c1CC |
|
~76%
benzyl 3,4-diet... CAS#:59435-27-7 |
| Literature: Pandey, Ravindra K.; Jackson, Anthony H.; Smith, Kevin M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 5 p. 1211 - 1220 |
| 3,4-diethyl-5-methyl-pyrrole-2-carboxylic acid benzyl ester |
| 2-methyl-3,4-diethyl-5-benzyloxycarbonylpyrrole |
| Benzyl 3,4-Diethyl-5-methylpyrrole-2-carboxylate |
| 1H-Pyrrole-2-carboxylic acid,3,4-diethyl-5-methyl-,phenylmethyl ester |
| benzyl-3,4-dimethyl-2-methyl-pyrrol-5-carboxylate |
| 3,4-Diethyl-5-methyl-1H-pyrrol-2-carboxylic acid benzyl ester |